| MolName | 2-[(Z)-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine |
| MolecularFormula | C13H12N6S |
| Smiles | NC(N)=N/N=C\c1c(-c2ccccc2)nc2sccn12 |
| InChI | InChI=1S/C13H12N6S/c14-12(15)18-16-8-10-11(9-4-2-1-3-5-9)17-13-19(10)6-7-20-13/h1-8H,(H4,14,15,18) |
| InChIK | KDBAPMXTNHFRIH-UHFFFAOYSA-N |
| TotalMolweight | 284.346 |
| Molweight | 284.346 |
| MonoisotopicMass | 284.084414 |
| CLogP | 2.7507 |
| CLogS | -3.543 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 217.74 |
| Relative PSA | 0.42638 |
| PolarSurfaceArea | 122.3 |
| Druglikeness | 3.4649 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.55 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 14 |
| Symmetricatoms | 3 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine | 2 - 2-[(Z)-(6-phenylimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]guanidine