| MolName | 2-hydroxy-N-[(Z)-[4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl]methylideneamino]-2,2-diphenylacetamide |
| MolecularFormula | C36H30N4O4 |
| Smiles | OC(C(N/N=C\c1ccc(/C=N\NC(C(c2ccccc2)(c2ccccc2)O)=O)cc1)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H30N4O4/c41-33(35(43,29-13-5-1-6-14-29)30-15-7-2-8-16-30)39-37-25-27-21-23-28(24-22-27)26-38-40-34(42)36(44,31-17-9-3-10-18-31)32-19-11-4-12-20-32/h1-26,43-44H,(H,39,41)(H,40,42) |
| InChIK | KDLANNQPNSOSDQ-UHFFFAOYSA-N |
| TotalMolweight | 582.658 |
| Molweight | 582.658 |
| MonoisotopicMass | 582.226706 |
| CLogP | 5.3042 |
| CLogS | -7.238 |
| H Acceptors | 8 |
| H Donors | 4 |
| TotalSurfaceArea | 453.76 |
| Relative PSA | 0.21646 |
| PolarSurfaceArea | 123.38 |
| Druglikeness | 5.4383 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 44 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Sp3Atoms | 4 |
| Symmetricatoms | 31 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-[4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl]methylideneamino]-2,2-diphenylacetamide | 2 - 2-hydroxy-N-[(Z)-[4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl]methylideneamino]-2,2-diphenylacetamide