| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-oxochromen-3-yl)methylideneamino]-5-phenyltriazole-4-carboxamide |
| MolecularFormula | C21H14N8O4 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\C2=COc(cccc3)c3C2=O)=O)c1-c1ccccc1 |
| InChI | InChI=1S/C21H14N8O4/c22-19-20(27-33-26-19)29-17(12-6-2-1-3-7-12)16(24-28-29)21(31)25-23-10-13-11-32-15-9-5-4-8-14(15)18(13)30/h1-11H,(H2,22,26)(H,25,31) |
| InChIK | KDUSTSPFQCDUQQ-UHFFFAOYSA-N |
| TotalMolweight | 442.394 |
| Molweight | 442.394 |
| MonoisotopicMass | 442.113802 |
| CLogP | 2.563 |
| CLogS | -3.756 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 327.92 |
| Relative PSA | 0.42443 |
| PolarSurfaceArea | 163.41 |
| Druglikeness | 2.3197 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | twice activated DB; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-oxochromen-3-yl)methylideneamino]-5-phenyltriazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-oxochromen-3-yl)methylideneamino]-5-phenyltriazole-4-carboxamide