| MolName | [(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]urea |
| MolecularFormula | C10H14N4O2S |
| Smiles | NC(N/N=C\c1ccc(N2CCOCC2)s1)=O |
| InChI | InChI=1S/C10H14N4O2S/c11-10(15)13-12-7-8-1-2-9(17-8)14-3-5-16-6-4-14/h1-2,7H,3-6H2,(H3,11,13,15) |
| InChIK | KDXRDMWASOCQMV-UHFFFAOYSA-N |
| TotalMolweight | 254.313 |
| Molweight | 254.313 |
| MonoisotopicMass | 254.083746 |
| CLogP | 0.8605 |
| CLogS | -3.077 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 193.53 |
| Relative PSA | 0.44019 |
| PolarSurfaceArea | 108.19 |
| Druglikeness | 6.201 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]urea | 2 - [(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]urea