| MolName | N-[(Z)-(3-phenoxyphenyl)methylideneamino]benzenesulfonamide |
| MolecularFormula | C19H16N2O3S |
| Smiles | O=S(c1ccccc1)(N/N=C\c1cc(Oc2ccccc2)ccc1)=O |
| InChI | InChI=1S/C19H16N2O3S/c22-25(23,19-12-5-2-6-13-19)21-20-15-16-8-7-11-18(14-16)24-17-9-3-1-4-10-17/h1-15,21H |
| InChIK | KDYPFWBVMATKRG-UHFFFAOYSA-N |
| TotalMolweight | 352.413 |
| Molweight | 352.413 |
| MonoisotopicMass | 352.088163 |
| CLogP | 3.6727 |
| CLogS | -4.213 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 267.58 |
| Relative PSA | 0.23002 |
| PolarSurfaceArea | 76.14 |
| Druglikeness | -5.0495 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-phenoxyphenyl)methylideneamino]benzenesulfonamide | 2 - N-[(Z)-(3-phenoxyphenyl)methylideneamino]benzenesulfonamide