| MolName | N-[(Z)-naphthalen-1-ylmethylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide |
| MolecularFormula | C22H17N5O3 |
| Smiles | [O-][N+](c1ccc(Cn(cc2)nc2C(N/N=C\c2cccc3ccccc23)=O)cc1)=O |
| InChI | InChI=1S/C22H17N5O3/c28-22(24-23-14-18-6-3-5-17-4-1-2-7-20(17)18)21-12-13-26(25-21)15-16-8-10-19(11-9-16)27(29)30/h1-14H,15H2,(H,24,28) |
| InChIK | KEIIGWHONSSNFA-UHFFFAOYSA-N |
| TotalMolweight | 399.409 |
| Molweight | 399.409 |
| MonoisotopicMass | 399.13314 |
| CLogP | 2.9482 |
| CLogS | -5.368 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 306.74 |
| Relative PSA | 0.27473 |
| PolarSurfaceArea | 105.1 |
| Druglikeness | 2.0767 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-naphthalen-1-ylmethylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide | 2 - N-[(Z)-naphthalen-1-ylmethylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide