| MolName | 2-(naphthalen-2-ylamino)-N-[(Z)-[4-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
| MolecularFormula | C32H28N6O2 |
| Smiles | O=C(CNc1cc2ccccc2cc1)N/N=C\c1ccc(/C=N\NC(CNc2cc3ccccc3cc2)=O)cc1 |
| InChI | InChI=1S/C32H28N6O2/c39-31(21-33-29-15-13-25-5-1-3-7-27(25)17-29)37-35-19-23-9-11-24(12-10-23)20-36-38-32(40)22-34-30-16-14-26-6-2-4-8-28(26)18-30/h1-20,33-34H,21-22H2,(H,37,39)(H,38,40) |
| InChIK | KEJKBIQFCOPOQI-UHFFFAOYSA-N |
| TotalMolweight | 528.614 |
| Molweight | 528.614 |
| MonoisotopicMass | 528.227374 |
| CLogP | 5.7162 |
| CLogS | -8.682 |
| H Acceptors | 8 |
| H Donors | 4 |
| TotalSurfaceArea | 420.36 |
| Relative PSA | 0.22585 |
| PolarSurfaceArea | 106.98 |
| Druglikeness | 5.0301 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 2 |
| Symmetricatoms | 21 |
| Amines | 2 |
| Aromatic Amines | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(naphthalen-2-ylamino)-N-[(Z)-[4-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide | 2 - 2-(naphthalen-2-ylamino)-N-[(Z)-[4-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide