| MolName | N-[2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| MolecularFormula | C18H16N3O4Br |
| Smiles | O=C(CNC(c(cc1)cc2c1OCCO2)=O)N/N=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C18H16BrN3O4/c19-14-3-1-2-12(8-14)10-21-22-17(23)11-20-18(24)13-4-5-15-16(9-13)26-7-6-25-15/h1-5,8-10H,6-7,11H2,(H,20,24)(H,22,23) |
| InChIK | KEOSIUJMIBTZQW-UHFFFAOYSA-N |
| TotalMolweight | 418.246 |
| Molweight | 418.246 |
| MonoisotopicMass | 417.032418 |
| CLogP | 2.9893 |
| CLogS | -4.504 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 282.61 |
| Relative PSA | 0.28488 |
| PolarSurfaceArea | 89.02 |
| Druglikeness | -3.6462 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide | 2 - N-[2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide