| MolName | 5-cyclopropyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1H-pyrazole-3-carboxamide |
| MolecularFormula | C21H20N4O2 |
| Smiles | O=C(c1n[nH]c(C2CC2)c1)N/N=C\c(cc1)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C21H20N4O2/c26-21(20-12-19(23-24-20)17-8-9-17)25-22-13-15-6-10-18(11-7-15)27-14-16-4-2-1-3-5-16/h1-7,10-13,17H,8-9,14H2,(H,23,24)(H,25,26) |
| InChIK | KFEBZGCKMKEQRJ-UHFFFAOYSA-N |
| TotalMolweight | 360.416 |
| Molweight | 360.416 |
| MonoisotopicMass | 360.158626 |
| CLogP | 3.6621 |
| CLogS | -4.64 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 285.36 |
| Relative PSA | 0.2487 |
| PolarSurfaceArea | 79.37 |
| Druglikeness | 6.3072 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7037 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 5 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-cyclopropyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1H-pyrazole-3-carboxamide | 2 - 5-cyclopropyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-1H-pyrazole-3-carboxamide