| MolName | 2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-phenoxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C30H26N6O2S |
| Smiles | O=C(CSc1nnc(CNc2ccccc2)n1-c1ccccc1)N/N=C\c1cc(Oc2ccccc2)ccc1 |
| InChI | InChI=1S/C30H26N6O2S/c37-29(34-32-20-23-11-10-18-27(19-23)38-26-16-8-3-9-17-26)22-39-30-35-33-28(21-31-24-12-4-1-5-13-24)36(30)25-14-6-2-7-15-25/h1-20,31H,21-22H2,(H,34,37) |
| InChIK | KFFOVPVLXISNBS-UHFFFAOYSA-N |
| TotalMolweight | 534.642 |
| Molweight | 534.642 |
| MonoisotopicMass | 534.183794 |
| CLogP | 5.239 |
| CLogS | -9.235 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 419.46 |
| Relative PSA | 0.24739 |
| PolarSurfaceArea | 118.73 |
| Druglikeness | 5.7912 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58974 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 11 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-phenoxyphenyl)methylideneamino]acetamide | 2 - 2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-phenoxyphenyl)methylideneamino]acetamide