| MolName | N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide |
| MolecularFormula | C22H20N4O4S |
| Smiles | O=C(c(cc1)cc2c1OCO2)N/N=C\c1c(-c2ccccc2)nc(N2CCOCC2)s1 |
| InChI | InChI=1S/C22H20N4O4S/c27-21(16-6-7-17-18(12-16)30-14-29-17)25-23-13-19-20(15-4-2-1-3-5-15)24-22(31-19)26-8-10-28-11-9-26/h1-7,12-13H,8-11,14H2,(H,25,27) |
| InChIK | KFGZUQSGEWYKMO-UHFFFAOYSA-N |
| TotalMolweight | 436.491 |
| Molweight | 436.491 |
| MonoisotopicMass | 436.120526 |
| CLogP | 4.4397 |
| CLogS | -6.156 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 323.55 |
| Relative PSA | 0.31182 |
| PolarSurfaceArea | 113.52 |
| Druglikeness | 6.1218 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide | 2 - N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide