| MolName | 1-benzyl-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]thiourea |
| MolecularFormula | C15H13N3Cl2S |
| Smiles | S=C(NCc1ccccc1)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C15H13Cl2N3S/c16-13-7-6-12(14(17)8-13)10-19-20-15(21)18-9-11-4-2-1-3-5-11/h1-8,10H,9H2,(H2,18,20,21) |
| InChIK | KFRLLTNKWTVFNZ-UHFFFAOYSA-N |
| TotalMolweight | 338.261 |
| Molweight | 338.261 |
| MonoisotopicMass | 337.020721 |
| CLogP | 4.5136 |
| CLogS | -5.609 |
| H Acceptors | 3 |
| H Donors | 2 |
| TotalSurfaceArea | 258.01 |
| Relative PSA | 0.24197 |
| PolarSurfaceArea | 68.51 |
| Druglikeness | 2.6862 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-benzyl-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]thiourea | 2 - 1-benzyl-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]thiourea