| MolName | 3-[5-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| MolecularFormula | C20H15N3O7 |
| Smiles | [O-][N+](c(cccc1)c1OCC(N/N=C\c1ccc(-c2cc(C(O)=O)ccc2)o1)=O)=O |
| InChI | InChI=1S/C20H15N3O7/c24-19(12-29-18-7-2-1-6-16(18)23(27)28)22-21-11-15-8-9-17(30-15)13-4-3-5-14(10-13)20(25)26/h1-11H,12H2,(H,22,24)(H,25,26) |
| InChIK | KFVHAKJPTHRPEC-UHFFFAOYSA-N |
| TotalMolweight | 409.353 |
| Molweight | 409.353 |
| MonoisotopicMass | 409.091002 |
| CLogP | 2.2789 |
| CLogS | -5.434 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 307.97 |
| Relative PSA | 0.37887 |
| PolarSurfaceArea | 146.95 |
| Druglikeness | 1.2496 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[5-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid | 2 - 3-[5-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid