| MolName | N-[(E)-(4-bromophenyl)methylideneamino]-2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)acetamide |
| MolecularFormula | C12H10N5O3Br |
| Smiles | O=C(CC(C(N1)=O)=NNC1=O)N/N=C/c(cc1)ccc1Br |
| InChI | InChI=1S/C12H10BrN5O3/c13-8-3-1-7(2-4-8)6-14-17-10(19)5-9-11(20)15-12(21)18-16-9/h1-4,6H,5H2,(H,17,19)(H2,15,18,20,21) |
| InChIK | KGLFKVBVCAGPFG-UHFFFAOYSA-N |
| TotalMolweight | 352.147 |
| Molweight | 352.147 |
| MonoisotopicMass | 350.996701 |
| CLogP | 1.1988 |
| CLogS | -4.195 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 227.51 |
| Relative PSA | 0.42425 |
| PolarSurfaceArea | 112.02 |
| Druglikeness | 5.2401 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-(4-bromophenyl)methylideneamino]-2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)acetamide | 2 - N-[(E)-(4-bromophenyl)methylideneamino]-2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)acetamide