| MolName | 4-[(Z)-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
| MolecularFormula | C27H21N5O2S |
| Smiles | N#Cc1ccc(/C=N\N(C(c(cc2)cc(N3)c2OCC3=O)=CS2)/C2=N/CCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H21N5O2S/c28-15-20-6-8-21(9-7-20)16-30-32-24(22-10-11-25-23(14-22)31-26(33)17-34-25)18-35-27(32)29-13-12-19-4-2-1-3-5-19/h1-11,14,16,18H,12-13,17H2,(H,31,33) |
| InChIK | KGRHIRTZYGCEFP-UHFFFAOYSA-N |
| TotalMolweight | 479.563 |
| Molweight | 479.563 |
| MonoisotopicMass | 479.141595 |
| CLogP | 4.5961 |
| CLogS | -6.886 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 368.21 |
| Relative PSA | 0.25018 |
| PolarSurfaceArea | 115.38 |
| Druglikeness | 1.0103 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amides | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile | 2 - 4-[(Z)-[4-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile