| MolName | 2-[2-[(Z)-[[2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| MolecularFormula | C27H23N4O5S2 |
| Smiles | [O-]C(COc1c(/C=N\NC(CSC(N2c3ccccc3)=Nc(sc3c4CCCC3)c4C2=O)=O)cccc1)=O |
| InChI | InChI=1S/C27H24N4O5S2/c32-22(30-28-14-17-8-4-6-12-20(17)36-15-23(33)34)16-37-27-29-25-24(19-11-5-7-13-21(19)38-25)26(35)31(27)18-9-2-1-3-10-18/h1-4,6,8-10,12,14H,5,7,11,13,15-16H2,(H,30,32)(H,33,34)/p-1 |
| InChIK | KGSYMESHBPIOGG-UHFFFAOYSA-M |
| TotalMolweight | 547.635 |
| Molweight | 547.635 |
| MonoisotopicMass | 547.110986 |
| CLogP | 2.4075 |
| CLogS | -7.17 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 402.04 |
| Relative PSA | 0.34643 |
| PolarSurfaceArea | 177.03 |
| Druglikeness | 2.4543 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 9 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetate | 2 - 2-[2-[(Z)-[[2-[(4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetate