| MolName | [2-benzoyloxy-4-[(Z)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| MolecularFormula | C33H23N2O5Br |
| Smiles | O=C(Cc(c1ccccc11)ccc1Br)N/N=C\c(cc1)cc(OC(c2ccccc2)=O)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C33H23BrN2O5/c34-28-17-16-25(26-13-7-8-14-27(26)28)20-31(37)36-35-21-22-15-18-29(40-32(38)23-9-3-1-4-10-23)30(19-22)41-33(39)24-11-5-2-6-12-24/h1-19,21H,20H2,(H,36,37) |
| InChIK | KGTFAZCFAXOXBY-UHFFFAOYSA-N |
| TotalMolweight | 607.459 |
| Molweight | 607.459 |
| MonoisotopicMass | 606.079034 |
| CLogP | 7.9803 |
| CLogS | -9.066 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 429 |
| Relative PSA | 0.19135 |
| PolarSurfaceArea | 94.06 |
| Druglikeness | 2.239 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.4878 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [2-benzoyloxy-4-[(Z)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]phenyl] benzoate | 2 - [2-benzoyloxy-4-[(Z)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]phenyl] benzoate