| MolName | 2-nitro-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]aniline |
| MolecularFormula | C11H8N4O5 |
| Smiles | [O-][N+](c1ccc(/C=N/Nc(cccc2)c2[N+]([O-])=O)o1)=O |
| InChI | InChI=1S/C11H8N4O5/c16-14(17)10-4-2-1-3-9(10)13-12-7-8-5-6-11(20-8)15(18)19/h1-7,13H |
| InChIK | KHFVJEWSRCFERM-UHFFFAOYSA-N |
| TotalMolweight | 276.208 |
| Molweight | 276.208 |
| MonoisotopicMass | 276.049471 |
| CLogP | 2.5378 |
| CLogS | -4.276 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 206.27 |
| Relative PSA | 0.47472 |
| PolarSurfaceArea | 129.17 |
| Druglikeness | 0.98271 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-nitro-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]aniline | 2 - 2-nitro-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]aniline