| MolName | 2-[(4-cyclohexyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide |
| MolecularFormula | C23H24N6O3S |
| Smiles | [O-][N+](c1ccc(/C=N\NC(CSc2nnc(-c3ccccc3)n2C2CCCCC2)=O)cc1)=O |
| InChI | InChI=1S/C23H24N6O3S/c30-21(25-24-15-17-11-13-20(14-12-17)29(31)32)16-33-23-27-26-22(18-7-3-1-4-8-18)28(23)19-9-5-2-6-10-19/h1,3-4,7-8,11-15,19H,2,5-6,9-10,16H2,(H,25,30) |
| InChIK | KHNYZKXGOKFJTC-UHFFFAOYSA-N |
| TotalMolweight | 464.549 |
| Molweight | 464.549 |
| MonoisotopicMass | 464.163059 |
| CLogP | 4.1244 |
| CLogS | -6.066 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 356.19 |
| Relative PSA | 0.31649 |
| PolarSurfaceArea | 143.29 |
| Druglikeness | -4.7381 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 9 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(4-cyclohexyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide | 2 - 2-[(4-cyclohexyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide