| MolName | N-[(Z)-[1-(3-phenoxypropyl)indol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine |
| MolecularFormula | C25H22N4OS |
| Smiles | C(Cn1c(cccc2)c2c(/C=N\Nc2nc(cccc3)c3s2)c1)COc1ccccc1 |
| InChI | InChI=1S/C25H22N4OS/c1-2-9-20(10-3-1)30-16-8-15-29-18-19(21-11-4-6-13-23(21)29)17-26-28-25-27-22-12-5-7-14-24(22)31-25/h1-7,9-14,17-18H,8,15-16H2,(H,27,28) |
| InChIK | KHXFVHBMLFENTE-UHFFFAOYSA-N |
| TotalMolweight | 426.543 |
| Molweight | 426.543 |
| MonoisotopicMass | 426.151431 |
| CLogP | 7.5446 |
| CLogS | -5.529 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 333.38 |
| Relative PSA | 0.21348 |
| PolarSurfaceArea | 79.68 |
| Druglikeness | 4.03 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-(3-phenoxypropyl)indol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine | 2 - N-[(Z)-[1-(3-phenoxypropyl)indol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine