| MolName | 4-N-(4-fluorophenyl)-2-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C25H23N8O3F |
| Smiles | [O-][N+](c(cccc1)c1-c1ccc(/C=N\Nc2nc(Nc(cc3)ccc3F)nc(N3CCCCC3)n2)o1)=O |
| InChI | InChI=1S/C25H23FN8O3/c26-17-8-10-18(11-9-17)28-23-29-24(31-25(30-23)33-14-4-1-5-15-33)32-27-16-19-12-13-22(37-19)20-6-2-3-7-21(20)34(35)36/h2-3,6-13,16H,1,4-5,14-15H2,(H2,28,29,30,31,32) |
| InChIK | KHZAPFKLYDGRIF-UHFFFAOYSA-N |
| TotalMolweight | 502.509 |
| Molweight | 502.509 |
| MonoisotopicMass | 502.187715 |
| CLogP | 6.2328 |
| CLogS | -8.139 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 381.81 |
| Relative PSA | 0.3023 |
| PolarSurfaceArea | 137.29 |
| Druglikeness | -2.0124 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.51351 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-N-(4-fluorophenyl)-2-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 4-N-(4-fluorophenyl)-2-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine