| MolName | N-[(Z)-(4-phenylphenyl)methylideneamino]benzenesulfonamide |
| MolecularFormula | C19H16N2O2S |
| Smiles | O=S(c1ccccc1)(N/N=C\c(cc1)ccc1-c1ccccc1)=O |
| InChI | InChI=1S/C19H16N2O2S/c22-24(23,19-9-5-2-6-10-19)21-20-15-16-11-13-18(14-12-16)17-7-3-1-4-8-17/h1-15,21H |
| InChIK | KIBJUCRPKMUPRB-UHFFFAOYSA-N |
| TotalMolweight | 336.414 |
| Molweight | 336.414 |
| MonoisotopicMass | 336.093248 |
| CLogP | 3.9363 |
| CLogS | -4.002 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 257.58 |
| Relative PSA | 0.20013 |
| PolarSurfaceArea | 66.91 |
| Druglikeness | -5.1819 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 7 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-phenylphenyl)methylideneamino]benzenesulfonamide | 2 - N-[(Z)-(4-phenylphenyl)methylideneamino]benzenesulfonamide