| MolName | 3-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| MolecularFormula | C24H20N2O3S2 |
| Smiles | O=C(CSC1=S)N1/N=C\c(cc1)cc(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H20N2O3S2/c27-23-17-31-24(30)26(23)25-14-20-11-12-21(28-15-18-7-3-1-4-8-18)22(13-20)29-16-19-9-5-2-6-10-19/h1-14H,15-17H2 |
| InChIK | KIDFKCBCEKOBFS-UHFFFAOYSA-N |
| TotalMolweight | 448.566 |
| Molweight | 448.566 |
| MonoisotopicMass | 448.091533 |
| CLogP | 3.638 |
| CLogS | -5.947 |
| H Acceptors | 5 |
| TotalSurfaceArea | 343.57 |
| Relative PSA | 0.2724 |
| PolarSurfaceArea | 108.52 |
| Druglikeness | 3.5067 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one | 2 - 3-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one