| MolName | 2-[4-[(Z)-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)iminomethyl]phenoxy]acetate |
| MolecularFormula | C19H12N3O4S2 |
| Smiles | [O-]C(COc1ccc(/C=N\N(C=Nc2c3c(-c4cccs4)cs2)C3=O)cc1)=O |
| InChI | InChI=1S/C19H13N3O4S2/c23-16(24)9-26-13-5-3-12(4-6-13)8-21-22-11-20-18-17(19(22)25)14(10-28-18)15-2-1-7-27-15/h1-8,10-11H,9H2,(H,23,24)/p-1 |
| InChIK | KIEVEJHVFFIYTP-UHFFFAOYSA-M |
| TotalMolweight | 410.453 |
| Molweight | 410.453 |
| MonoisotopicMass | 410.026922 |
| CLogP | 1.1127 |
| CLogS | -5.649 |
| H Acceptors | 7 |
| TotalSurfaceArea | 297.77 |
| Relative PSA | 0.3951 |
| PolarSurfaceArea | 150.87 |
| Druglikeness | 7.0496 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)iminomethyl]phenoxy]acetate | 2 - 2-[4-[(Z)-(4-oxo-5-thiophen-2-ylthieno[2,3-d]pyrimidin-3-yl)iminomethyl]phenoxy]acetate