| MolName | 2-[3-[(Z)-(diphenylhydrazinylidene)methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide |
| MolecularFormula | C29H23N4OF |
| Smiles | O=C(Cn1c(cccc2)c2c(/C=N\N(c2ccccc2)c2ccccc2)c1)Nc(cc1)ccc1F |
| InChI | InChI=1S/C29H23FN4O/c30-23-15-17-24(18-16-23)32-29(35)21-33-20-22(27-13-7-8-14-28(27)33)19-31-34(25-9-3-1-4-10-25)26-11-5-2-6-12-26/h1-20H,21H2,(H,32,35) |
| InChIK | KIMKQOIUSONNHQ-UHFFFAOYSA-N |
| TotalMolweight | 462.527 |
| Molweight | 462.527 |
| MonoisotopicMass | 462.185589 |
| CLogP | 6.1439 |
| CLogS | -7.207 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 360.72 |
| Relative PSA | 0.12871 |
| PolarSurfaceArea | 49.63 |
| Druglikeness | 4.513 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51429 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 1 |
| Symmetricatoms | 10 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[3-[(Z)-(diphenylhydrazinylidene)methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide | 2 - 2-[3-[(Z)-(diphenylhydrazinylidene)methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide