| MolName | 2,2-diphenyl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]cyclopropane-1-carboxamide |
| MolecularFormula | C25H22N2O |
| Smiles | O=C(C(C1)C1(c1ccccc1)c1ccccc1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C25H22N2O/c28-24(27-26-18-10-13-20-11-4-1-5-12-20)23-19-25(23,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-18,23H,19H2,(H,27,28)/t23-/m1/s1 |
| InChIK | KISNQLLWPPTQMN-HSZRJFAPSA-N |
| TotalMolweight | 366.463 |
| Molweight | 366.463 |
| MonoisotopicMass | 366.173213 |
| CLogP | 4.8261 |
| CLogS | -4.994 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 296.42 |
| Relative PSA | 0.12148 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 5.6377 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| StereoCenters | 1 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 10 |
| StereoCon | racemate |
Click to Load Molecule:
1 - 2,2-diphenyl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]cyclopropane-1-carboxamide | 2 - 2,2-diphenyl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]cyclopropane-1-carboxamide