| MolName | 4-[(Z)-[4-(5-bromothiophen-2-yl)-2-(2-fluorophenyl)imino-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
| MolecularFormula | C21H12N4BrFS2 |
| Smiles | N#Cc1ccc(/C=N\N(C(c(s2)ccc2Br)=CS2)/C2=N/c(cccc2)c2F)cc1 |
| InChI | InChI=1S/C21H12BrFN4S2/c22-20-10-9-19(29-20)18-13-28-21(26-17-4-2-1-3-16(17)23)27(18)25-12-15-7-5-14(11-24)6-8-15/h1-10,12-13H |
| InChIK | KIXPCHLIWVOFMA-UHFFFAOYSA-N |
| TotalMolweight | 483.388 |
| Molweight | 483.388 |
| MonoisotopicMass | 481.967075 |
| CLogP | 6.097 |
| CLogS | -7.582 |
| H Acceptors | 4 |
| TotalSurfaceArea | 322.14 |
| Relative PSA | 0.24207 |
| PolarSurfaceArea | 105.29 |
| Druglikeness | -4.0775 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[4-(5-bromothiophen-2-yl)-2-(2-fluorophenyl)imino-1,3-thiazol-3-yl]iminomethyl]benzonitrile | 2 - 4-[(Z)-[4-(5-bromothiophen-2-yl)-2-(2-fluorophenyl)imino-1,3-thiazol-3-yl]iminomethyl]benzonitrile