| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(azepan-1-ylmethyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]triazole-4-carboxamide |
| MolecularFormula | C21H25N9O2 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\C=C\c2ccccc2)=O)c1CN1CCCCCC1 |
| InChI | InChI=1S/C21H25N9O2/c22-19-20(27-32-26-19)30-17(15-29-13-6-1-2-7-14-29)18(24-28-30)21(31)25-23-12-8-11-16-9-4-3-5-10-16/h3-5,8-12H,1-2,6-7,13-15H2,(H2,22,26)(H,25,31) |
| InChIK | KIZMKGDLYMEGTB-UHFFFAOYSA-N |
| TotalMolweight | 435.49 |
| Molweight | 435.49 |
| MonoisotopicMass | 435.213121 |
| CLogP | 2.8656 |
| CLogS | -2.484 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 348.82 |
| Relative PSA | 0.34313 |
| PolarSurfaceArea | 140.35 |
| Druglikeness | -1.0986 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 8 |
| Symmetricatoms | 5 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(azepan-1-ylmethyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(azepan-1-ylmethyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]triazole-4-carboxamide