| MolName | 4-chloro-3-[5-[(E)-[(5-nitropyridin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| MolecularFormula | C17H11N4O5Cl |
| Smiles | [O-][N+](c(cc1)cnc1N/N=C/c1ccc(-c(cc(cc2)C(O)=O)c2Cl)o1)=O |
| InChI | InChI=1S/C17H11ClN4O5/c18-14-4-1-10(17(23)24)7-13(14)15-5-3-12(27-15)9-20-21-16-6-2-11(8-19-16)22(25)26/h1-9H,(H,19,21)(H,23,24) |
| InChIK | KIZZFQSXCFUKOP-UHFFFAOYSA-N |
| TotalMolweight | 386.75 |
| Molweight | 386.75 |
| MonoisotopicMass | 386.041798 |
| CLogP | 4.2998 |
| CLogS | -5.548 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 280.64 |
| Relative PSA | 0.37276 |
| PolarSurfaceArea | 133.54 |
| Druglikeness | -0.79092 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-3-[5-[(E)-[(5-nitropyridin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzoic acid | 2 - 4-chloro-3-[5-[(E)-[(5-nitropyridin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzoic acid