| MolName | [1-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate |
| MolecularFormula | C29H20N4O4Cl2S |
| Smiles | N#Cc1c(NC(C(N/N=C\c(c2ccccc2cc2)c2OC(c(ccc(Cl)c2)c2Cl)=O)=O)=O)sc2c1CCCC2 |
| InChI | InChI=1S/C29H20Cl2N4O4S/c30-17-10-11-20(23(31)13-17)29(38)39-24-12-9-16-5-1-2-6-18(16)22(24)15-33-35-27(37)26(36)34-28-21(14-32)19-7-3-4-8-25(19)40-28/h1-2,5-6,9-13,15H,3-4,7-8H2,(H,34,36)(H,35,37) |
| InChIK | KJBXNUBUYQRNGG-UHFFFAOYSA-N |
| TotalMolweight | 591.474 |
| Molweight | 591.474 |
| MonoisotopicMass | 590.05823 |
| CLogP | 7.0294 |
| CLogS | -10.098 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 428.34 |
| Relative PSA | 0.27424 |
| PolarSurfaceArea | 148.89 |
| Druglikeness | -4.4322 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate | 2 - [1-[(Z)-[[2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2,4-dichlorobenzoate