| MolName | 3-(3-chlorophenyl)-4-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C15H9N4Cl3S |
| Smiles | S=C(NN=C1c2cc(Cl)ccc2)N1/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C15H9Cl3N4S/c16-11-3-1-2-9(6-11)14-20-21-15(23)22(14)19-8-10-4-5-12(17)7-13(10)18/h1-8H,(H,21,23) |
| InChIK | KJHPIOGPBMJZQM-UHFFFAOYSA-N |
| TotalMolweight | 383.689 |
| Molweight | 383.689 |
| MonoisotopicMass | 381.961347 |
| CLogP | 5.113 |
| CLogS | -6.659 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 267.98 |
| Relative PSA | 0.2464 |
| PolarSurfaceArea | 72.08 |
| Druglikeness | 3.6145 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.56522 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(3-chlorophenyl)-4-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(3-chlorophenyl)-4-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione