| MolName | 2-[2-[(Z)-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetonitrile |
| MolecularFormula | C16H8N3OF7 |
| Smiles | N#CCOc1c(/C=N\Nc(c(F)c(c(C(F)(F)F)c2F)F)c2F)cccc1 |
| InChI | InChI=1S/C16H8F7N3O/c17-11-10(16(21,22)23)12(18)14(20)15(13(11)19)26-25-7-8-3-1-2-4-9(8)27-6-5-24/h1-4,7,26H,6H2 |
| InChIK | KJXQTARERORJMT-UHFFFAOYSA-N |
| TotalMolweight | 391.246 |
| Molweight | 391.246 |
| MonoisotopicMass | 391.055558 |
| CLogP | 5.6743 |
| CLogS | -5.649 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 269.57 |
| Relative PSA | 0.17261 |
| PolarSurfaceArea | 57.41 |
| Druglikeness | -9.8412 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetonitrile | 2 - 2-[2-[(Z)-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetonitrile