| MolName | 3-N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine |
| MolecularFormula | C13H11N6OBr |
| Smiles | Nn1c(N/N=C\c2ccc(-c(cc3)ccc3Br)o2)nnc1 |
| InChI | InChI=1S/C13H11BrN6O/c14-10-3-1-9(2-4-10)12-6-5-11(21-12)7-16-18-13-19-17-8-20(13)15/h1-8H,15H2,(H,18,19) |
| InChIK | KJYDYCDDHMLOJZ-UHFFFAOYSA-N |
| TotalMolweight | 347.175 |
| Molweight | 347.175 |
| MonoisotopicMass | 346.01777 |
| CLogP | 4.6669 |
| CLogS | -7.048 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 232.56 |
| Relative PSA | 0.34899 |
| PolarSurfaceArea | 94.26 |
| Druglikeness | 2.1518 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine | 2 - 3-N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine