| MolName | N-(4-fluorophenyl)-2-[3-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]indol-1-yl]acetamide |
| MolecularFormula | C24H20N5O2F |
| Smiles | O=C(Cn1c(cccc2)c2c(/C=N\NC(Nc2ccccc2)=O)c1)Nc(cc1)ccc1F |
| InChI | InChI=1S/C24H20FN5O2/c25-18-10-12-20(13-11-18)27-23(31)16-30-15-17(21-8-4-5-9-22(21)30)14-26-29-24(32)28-19-6-2-1-3-7-19/h1-15H,16H2,(H,27,31)(H2,28,29,32) |
| InChIK | KKCKMYOZOMGUEJ-UHFFFAOYSA-N |
| TotalMolweight | 429.454 |
| Molweight | 429.454 |
| MonoisotopicMass | 429.160103 |
| CLogP | 4.1106 |
| CLogS | -5.718 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 331.33 |
| Relative PSA | 0.23795 |
| PolarSurfaceArea | 87.52 |
| Druglikeness | 5.0417 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(4-fluorophenyl)-2-[3-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]indol-1-yl]acetamide | 2 - N-(4-fluorophenyl)-2-[3-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]indol-1-yl]acetamide