| MolName | 2-[5-[(2-chloroacetyl)amino]-1,3,4-thiadiazol-2-yl]-N-[(Z)-(4-chlorophenyl)methylideneamino]acetamide |
| MolecularFormula | C13H11N5O2Cl2S |
| Smiles | O=C(Cc1nnc(NC(CCl)=O)s1)N/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C13H11Cl2N5O2S/c14-6-11(22)17-13-20-19-12(23-13)5-10(21)18-16-7-8-1-3-9(15)4-2-8/h1-4,7H,5-6H2,(H,18,21)(H,17,20,22) |
| InChIK | KKHHQRVUIDVLOD-UHFFFAOYSA-N |
| TotalMolweight | 372.235 |
| Molweight | 372.235 |
| MonoisotopicMass | 371.001049 |
| CLogP | 2.5817 |
| CLogS | -4.372 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 268.02 |
| Relative PSA | 0.38359 |
| PolarSurfaceArea | 124.58 |
| Druglikeness | 6.3586 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73913 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[5-[(2-chloroacetyl)amino]-1,3,4-thiadiazol-2-yl]-N-[(Z)-(4-chlorophenyl)methylideneamino]acetamide | 2 - 2-[5-[(2-chloroacetyl)amino]-1,3,4-thiadiazol-2-yl]-N-[(Z)-(4-chlorophenyl)methylideneamino]acetamide