| MolName | N-[(Z)-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| MolecularFormula | C38H27N4O2Br |
| Smiles | O=C(CN(c1c2cccc1)c(cccc1)c1C2=O)N/N=C\c(cc1-c2ccccc2)c(-c2ccccc2)n1-c(cc1)ccc1Br |
| InChI | InChI=1S/C38H27BrN4O2/c39-29-19-21-30(22-20-29)43-35(26-11-3-1-4-12-26)23-28(37(43)27-13-5-2-6-14-27)24-40-41-36(44)25-42-33-17-9-7-15-31(33)38(45)32-16-8-10-18-34(32)42/h1-24H,25H2,(H,41,44) |
| InChIK | KKQTUOMXPWVPRC-UHFFFAOYSA-N |
| TotalMolweight | 651.562 |
| Molweight | 651.562 |
| MonoisotopicMass | 650.131737 |
| CLogP | 8.7184 |
| CLogS | -13.256 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 462.17 |
| Relative PSA | 0.12868 |
| PolarSurfaceArea | 66.7 |
| Druglikeness | 4.8362 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.4 |
| Fragments | 1 |
| Non HAtoms | 45 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 35 |
| Sp3Atoms | 2 |
| Symmetricatoms | 12 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide | 2 - N-[(Z)-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide