| MolName | N-[(Z)-(4-chlorophenyl)methylideneamino]-1,4,5,6-tetrahydrocyclopenta[c]pyrazole-3-carboxamide |
| MolecularFormula | C14H13N4OCl |
| Smiles | O=C(c1n[nH]c2c1CCC2)N/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C14H13ClN4O/c15-10-6-4-9(5-7-10)8-16-19-14(20)13-11-2-1-3-12(11)17-18-13/h4-8H,1-3H2,(H,17,18)(H,19,20) |
| InChIK | KLJBNMCVQCFPSU-UHFFFAOYSA-N |
| TotalMolweight | 288.737 |
| Molweight | 288.737 |
| MonoisotopicMass | 288.077788 |
| CLogP | 2.624 |
| CLogS | -3.9 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 218.52 |
| Relative PSA | 0.27901 |
| PolarSurfaceArea | 70.14 |
| Druglikeness | 3.5052 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-chlorophenyl)methylideneamino]-1,4,5,6-tetrahydrocyclopenta[c]pyrazole-3-carboxamide | 2 - N-[(Z)-(4-chlorophenyl)methylideneamino]-1,4,5,6-tetrahydrocyclopenta[c]pyrazole-3-carboxamide