| MolName | 5-amino-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1-phenylpyrazole-4-carboxamide |
| MolecularFormula | C18H15N5O3 |
| Smiles | Nc(n(-c1ccccc1)nc1)c1C(N/N=C\c(cc1)cc2c1OCO2)=O |
| InChI | InChI=1S/C18H15N5O3/c19-17-14(10-21-23(17)13-4-2-1-3-5-13)18(24)22-20-9-12-6-7-15-16(8-12)26-11-25-15/h1-10H,11,19H2,(H,22,24) |
| InChIK | KLQDCZHPNCLLKB-UHFFFAOYSA-N |
| TotalMolweight | 349.349 |
| Molweight | 349.349 |
| MonoisotopicMass | 349.11749 |
| CLogP | 2.1559 |
| CLogS | -4.768 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 263.49 |
| Relative PSA | 0.33823 |
| PolarSurfaceArea | 103.76 |
| Druglikeness | 6.355 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-amino-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1-phenylpyrazole-4-carboxamide | 2 - 5-amino-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1-phenylpyrazole-4-carboxamide