| MolName | [2-benzoyloxy-4-[(Z)-[[2-[(2,2-diphenylacetyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| MolecularFormula | C37H29N3O6 |
| Smiles | O=C(CNC(C(c1ccccc1)c1ccccc1)=O)N/N=C\c(cc1)cc(OC(c2ccccc2)=O)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C37H29N3O6/c41-33(25-38-35(42)34(27-13-5-1-6-14-27)28-15-7-2-8-16-28)40-39-24-26-21-22-31(45-36(43)29-17-9-3-10-18-29)32(23-26)46-37(44)30-19-11-4-12-20-30/h1-24,34H,25H2,(H,38,42)(H,40,41) |
| InChIK | KLTMCCXOBURSKH-UHFFFAOYSA-N |
| TotalMolweight | 611.652 |
| Molweight | 611.652 |
| MonoisotopicMass | 611.205637 |
| CLogP | 6.672 |
| CLogS | -7.542 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 477.24 |
| Relative PSA | 0.22335 |
| PolarSurfaceArea | 123.16 |
| Druglikeness | 6.0379 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.47826 |
| Fragments | 1 |
| Non HAtoms | 46 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 13 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Sp3Atoms | 4 |
| Symmetricatoms | 12 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-benzoyloxy-4-[(Z)-[[2-[(2,2-diphenylacetyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate | 2 - [2-benzoyloxy-4-[(Z)-[[2-[(2,2-diphenylacetyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate