| MolName | 3-[2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-5H-pyrimido[4,5-e][1,2,4]triazine-6,8-dione |
| MolecularFormula | C10H6N8O5 |
| Smiles | [O-][N+](c1ccc(C=NNc(nc2NC(N3)=O)nnc2C3=O)o1)=O |
| InChI | InChI=1S/C10H6N8O5/c19-8-6-7(13-10(20)14-8)12-9(17-15-6)16-11-3-4-1-2-5(23-4)18(21)22/h1-3H,(H3,12,13,14,16,17,19,20) |
| InChIK | KLYIHEUFYSXCCD-UHFFFAOYSA-N |
| TotalMolweight | 318.209 |
| Molweight | 318.209 |
| MonoisotopicMass | 318.046117 |
| CLogP | 0.6946 |
| CLogS | -4.068 |
| H Acceptors | 13 |
| H Donors | 3 |
| TotalSurfaceArea | 223.8 |
| Relative PSA | 0.6676 |
| PolarSurfaceArea | 180.22 |
| Druglikeness | 2.3005 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Amides | 2 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-5H-pyrimido[4,5-e][1,2,4]triazine-6,8-dione | 2 - 3-[2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-5H-pyrimido[4,5-e][1,2,4]triazine-6,8-dione