| MolName | N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]naphthalene-2-carboxamide |
| MolecularFormula | C22H15N3O4 |
| Smiles | [O-][N+](c(cccc1)c1-c1ccc(/C=N\NC(c2cc3ccccc3cc2)=O)o1)=O |
| InChI | InChI=1S/C22H15N3O4/c26-22(17-10-9-15-5-1-2-6-16(15)13-17)24-23-14-18-11-12-21(29-18)19-7-3-4-8-20(19)25(27)28/h1-14H,(H,24,26) |
| InChIK | KLZQDCRMBTUGTP-UHFFFAOYSA-N |
| TotalMolweight | 385.378 |
| Molweight | 385.378 |
| MonoisotopicMass | 385.106257 |
| CLogP | 4.4133 |
| CLogS | -7.247 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 294.71 |
| Relative PSA | 0.27329 |
| PolarSurfaceArea | 100.42 |
| Druglikeness | 1.38 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58621 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]naphthalene-2-carboxamide | 2 - N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]naphthalene-2-carboxamide