| MolName | 2-amino-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]benzamide |
| MolecularFormula | C14H11N3OCl2 |
| Smiles | Nc(cccc1)c1C(N/N=C\c(cc1)cc(Cl)c1Cl)=O |
| InChI | InChI=1S/C14H11Cl2N3O/c15-11-6-5-9(7-12(11)16)8-18-19-14(20)10-3-1-2-4-13(10)17/h1-8H,17H2,(H,19,20) |
| InChIK | KMBMDOLOLBQDFE-UHFFFAOYSA-N |
| TotalMolweight | 308.167 |
| Molweight | 308.167 |
| MonoisotopicMass | 307.027916 |
| CLogP | 3.7363 |
| CLogS | -5.269 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 226.35 |
| Relative PSA | 0.22655 |
| PolarSurfaceArea | 67.48 |
| Druglikeness | 4.4006 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-amino-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]benzamide | 2 - 2-amino-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]benzamide