| MolName | N-[(Z)-furan-2-ylmethylideneamino]-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| MolecularFormula | C20H16N6O2S |
| Smiles | O=C(CSc1nnc(-c2ccncc2)n1-c1ccccc1)N/N=C\c1ccco1 |
| InChI | InChI=1S/C20H16N6O2S/c27-18(23-22-13-17-7-4-12-28-17)14-29-20-25-24-19(15-8-10-21-11-9-15)26(20)16-5-2-1-3-6-16/h1-13H,14H2,(H,23,27) |
| InChIK | KMBYQPDZCRJDEL-UHFFFAOYSA-N |
| TotalMolweight | 404.453 |
| Molweight | 404.453 |
| MonoisotopicMass | 404.105544 |
| CLogP | 2.7196 |
| CLogS | -7.303 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 312.93 |
| Relative PSA | 0.34318 |
| PolarSurfaceArea | 123.5 |
| Druglikeness | 5.2993 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-furan-2-ylmethylideneamino]-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide | 2 - N-[(Z)-furan-2-ylmethylideneamino]-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide