| MolName | N-[(Z)-[2-(difluoromethoxy)-5-nitrophenyl]methylideneamino]-1-oxidopyridin-1-ium-2-carboxamide |
| MolecularFormula | C14H10N4O5F2 |
| Smiles | [O-][N+](c(cc1)cc(/C=N\NC(c(cccc2)[n+]2[O-])=O)c1OC(F)F)=O |
| InChI | InChI=1S/C14H10F2N4O5/c15-14(16)25-12-5-4-10(20(23)24)7-9(12)8-17-18-13(21)11-3-1-2-6-19(11)22/h1-8,14H,(H,18,21) |
| InChIK | KMEOFTBMIADCFU-UHFFFAOYSA-N |
| TotalMolweight | 352.252 |
| Molweight | 352.252 |
| MonoisotopicMass | 352.061927 |
| CLogP | 1.027 |
| CLogS | -6.416 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 247.91 |
| Relative PSA | 0.36582 |
| PolarSurfaceArea | 121.97 |
| Druglikeness | -3.6419 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-(difluoromethoxy)-5-nitrophenyl]methylideneamino]-1-oxidopyridin-1-ium-2-carboxamide | 2 - N-[(Z)-[2-(difluoromethoxy)-5-nitrophenyl]methylideneamino]-1-oxidopyridin-1-ium-2-carboxamide