| MolName | N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide |
| MolecularFormula | C26H22N4O2 |
| Smiles | O=C(c1c(CCc2c-3cccc2)c3n[nH]1)N/N=C\c1cc(OCc2ccccc2)ccc1 |
| InChI | InChI=1S/C26H22N4O2/c31-26(25-23-14-13-20-10-4-5-12-22(20)24(23)28-29-25)30-27-16-19-9-6-11-21(15-19)32-17-18-7-2-1-3-8-18/h1-12,15-16H,13-14,17H2,(H,28,29)(H,30,31) |
| InChIK | KMLMWDMMDPQLTB-UHFFFAOYSA-N |
| TotalMolweight | 422.487 |
| Molweight | 422.487 |
| MonoisotopicMass | 422.174276 |
| CLogP | 4.7203 |
| CLogS | -5.989 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 332.62 |
| Relative PSA | 0.21337 |
| PolarSurfaceArea | 79.37 |
| Druglikeness | 4.4367 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide | 2 - N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide