| MolName | 6-[2-(4-fluorophenyl)imino-3-[(Z)-(3-phenoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| MolecularFormula | C30H21N4O3FS |
| Smiles | O=C1Nc(cc(cc2)C(N3/N=C\c4cc(Oc5ccccc5)ccc4)=CS/C3=N\c(cc3)ccc3F)c2OC1 |
| InChI | InChI=1S/C30H21FN4O3S/c31-22-10-12-23(13-11-22)33-30-35(27(19-39-30)21-9-14-28-26(16-21)34-29(36)18-37-28)32-17-20-5-4-8-25(15-20)38-24-6-2-1-3-7-24/h1-17,19H,18H2,(H,34,36) |
| InChIK | KMMWMFVPCXTSCA-UHFFFAOYSA-N |
| TotalMolweight | 536.586 |
| Molweight | 536.586 |
| MonoisotopicMass | 536.131839 |
| CLogP | 5.7228 |
| CLogS | -8.451 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 395.09 |
| Relative PSA | 0.22415 |
| PolarSurfaceArea | 100.82 |
| Druglikeness | 3.2446 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46154 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-[2-(4-fluorophenyl)imino-3-[(Z)-(3-phenoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one | 2 - 6-[2-(4-fluorophenyl)imino-3-[(Z)-(3-phenoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one