| MolName | N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine |
| MolecularFormula | C25H29N6OCl |
| Smiles | Clc(cc1)ccc1-c1ccc(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)c2)o1 |
| InChI | InChI=1S/C25H29ClN6O/c26-20-9-7-19(8-10-20)22-12-11-21(33-22)18-27-30-23-17-24(31-13-3-1-4-14-31)29-25(28-23)32-15-5-2-6-16-32/h7-12,17-18H,1-6,13-16H2,(H,28,29,30) |
| InChIK | KMYIXAYGATUCDI-UHFFFAOYSA-N |
| TotalMolweight | 464.999 |
| Molweight | 464.999 |
| MonoisotopicMass | 464.209136 |
| CLogP | 7.5609 |
| CLogS | -7.646 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 362.83 |
| Relative PSA | 0.18223 |
| PolarSurfaceArea | 69.79 |
| Druglikeness | 4.3347 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 10 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine | 2 - N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine