| MolName | N-[(Z)-(2,4-difluorophenyl)methylideneamino]-2-fluorobenzamide |
| MolecularFormula | C14H9N2OF3 |
| Smiles | O=C(c(cccc1)c1F)N/N=C\c(ccc(F)c1)c1F |
| InChI | InChI=1S/C14H9F3N2O/c15-10-6-5-9(13(17)7-10)8-18-19-14(20)11-3-1-2-4-12(11)16/h1-8H,(H,19,20) |
| InChIK | KNFWYOBAHYAKNN-UHFFFAOYSA-N |
| TotalMolweight | 278.232 |
| Molweight | 278.232 |
| MonoisotopicMass | 278.066697 |
| CLogP | 3.504 |
| CLogS | -4.663 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 206.04 |
| Relative PSA | 0.17477 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 3.1287 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-difluorophenyl)methylideneamino]-2-fluorobenzamide | 2 - N-[(Z)-(2,4-difluorophenyl)methylideneamino]-2-fluorobenzamide