| MolName | (Z)-N-(9H-fluoren-2-yl)-3-phenylprop-2-en-1-imine |
| MolecularFormula | C22H17N |
| Smiles | C1c(cc(cc2)/N=C/C=C\c3ccccc3)c2-c2c1cccc2 |
| InChI | InChI=1S/C22H17N/c1-2-7-17(8-3-1)9-6-14-23-20-12-13-22-19(16-20)15-18-10-4-5-11-21(18)22/h1-14,16H,15H2 |
| InChIK | KNNZYQMTSPFAGR-UHFFFAOYSA-N |
| TotalMolweight | 295.384 |
| Molweight | 295.384 |
| MonoisotopicMass | 295.136099 |
| CLogP | 5.07 |
| CLogS | -6.161 |
| H Acceptors | 1 |
| TotalSurfaceArea | 244.3 |
| Relative PSA | 0.047114 |
| PolarSurfaceArea | 12.36 |
| Druglikeness | -0.28121 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 1 |
| Electronegative Atoms | 1 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-(9H-fluoren-2-yl)-3-phenylprop-2-en-1-imine | 2 - (Z)-N-(9H-fluoren-2-yl)-3-phenylprop-2-en-1-imine