| MolName | 2-N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-6-morpholin-4-yl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C25H20N8O4ClF3 |
| Smiles | [O-][N+](c(cc1)cc(Cl)c1-c1ccc(/C=N\Nc2nc(N3CCOCC3)nc(Nc3cc(C(F)(F)F)ccc3)n2)o1)=O |
| InChI | InChI=1S/C25H20ClF3N8O4/c26-20-13-17(37(38)39)4-6-19(20)21-7-5-18(41-21)14-30-35-23-32-22(33-24(34-23)36-8-10-40-11-9-36)31-16-3-1-2-15(12-16)25(27,28)29/h1-7,12-14H,8-11H2,(H2,31,32,33,34,35) |
| InChIK | KNYKSMRTBCTAMU-UHFFFAOYSA-N |
| TotalMolweight | 588.933 |
| Molweight | 588.933 |
| MonoisotopicMass | 588.124813 |
| CLogP | 6.4223 |
| CLogS | -8.45 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 416.58 |
| Relative PSA | 0.30107 |
| PolarSurfaceArea | 146.52 |
| Druglikeness | -6.9467 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5122 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-6-morpholin-4-yl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-6-morpholin-4-yl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine